C16H28N2O5S — CID 97441134
methyl 4-[(3aR,8aR)-2-(2-methylpropyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-4-oxobutanoate (PubChem CID 97441134) has the molecular formula C16H28N2O5S and a molecular weight of 360.48 g/mol. Its IUPAC name is methyl 4-[(3aR,8aR)-2-(2-methylpropyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[(3aR,8aR)-2-(2-methylpropyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 97441134 |
| Molecular Formula | C16H28N2O5S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl 4-[(3aR,8aR)-2-(2-methylpropyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CC[C@@H]2CN(CC(C)C)S(=O)(=O)[C@@H]2CC1 |
| InChI | InChI=1S/C16H28N2O5S/c1-12(2)10-18-11-13-6-8-17(9-7-14(13)24(18,21)22)15(19)4-5-16(20)23-3/h12-14H,4-11H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | XFJGTBYRERMKGJ-ZIAGYGMSSA-N |
| XLogP | 0.85 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |