C12H22N2O4S — CID 124789235
1-[(3aS,8aS)-2-(2-methoxyethyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]ethanone (PubChem CID 124789235) has the molecular formula C12H22N2O4S and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-[(3aS,8aS)-2-(2-methoxyethyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]ethanone.
| Compound Name | 1-[(3aS,8aS)-2-(2-methoxyethyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]ethanone |
|---|---|
| PubChem CID | 124789235 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[(3aS,8aS)-2-(2-methoxyethyl)-1,1-dioxo-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepin-6-yl]ethanone |
| SMILES | COCCN1C[C@@H]2CCN(C(C)=O)CC[C@@H]2S1(=O)=O |
| InChI | InChI=1S/C12H22N2O4S/c1-10(15)13-5-3-11-9-14(7-8-18-2)19(16,17)12(11)4-6-13/h11-12H,3-9H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | CRZNJSAQDCDSAB-RYUDHWBXSA-N |
| XLogP | -0.09 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |