C14H22N4O3S — CID 97441166
(3aR,8aR)-2-(2-methoxyethyl)-6-pyrimidin-2-yl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide (PubChem CID 97441166) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (3aR,8aR)-2-(2-methoxyethyl)-6-pyrimidin-2-yl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide.
| Compound Name | (3aR,8aR)-2-(2-methoxyethyl)-6-pyrimidin-2-yl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
|---|---|
| PubChem CID | 97441166 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | (3aR,8aR)-2-(2-methoxyethyl)-6-pyrimidin-2-yl-3a,4,5,7,8,8a-hexahydro-3H-[1,2]thiazolo[4,5-d]azepine 1,1-dioxide |
| SMILES | COCCN1C[C@H]2CCN(c3ncccn3)CC[C@H]2S1(=O)=O |
| InChI | InChI=1S/C14H22N4O3S/c1-21-10-9-18-11-12-3-7-17(14-15-5-2-6-16-14)8-4-13(12)22(18,19)20/h2,5-6,12-13H,3-4,7-11H2,1H3/t12-,13-/m1/s1 |
| InChIKey | ZZHCULLVAJIYID-CHWSQXEVSA-N |
| XLogP | 0.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |