C23H22N4O2 — CID 97441738
3-(4-methoxy-N-methylanilino)-N-(pyridin-2-ylmethyl)indolizine-6-carboxamide (PubChem CID 97441738) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 3-(4-methoxy-N-methylanilino)-N-(pyridin-2-ylmethyl)indolizine-6-carboxamide.
| Compound Name | 3-(4-methoxy-N-methylanilino)-N-(pyridin-2-ylmethyl)indolizine-6-carboxamide |
|---|---|
| PubChem CID | 97441738 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-(4-methoxy-N-methylanilino)-N-(pyridin-2-ylmethyl)indolizine-6-carboxamide |
| SMILES | COc1ccc(N(C)c2ccc3ccc(C(=O)NCc4ccccn4)cn23)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-26(19-8-11-21(29-2)12-9-19)22-13-10-20-7-6-17(16-27(20)22)23(28)25-15-18-5-3-4-14-24-18/h3-14,16H,15H2,1-2H3,(H,25,28) |
| InChIKey | KRMOPNUYCXILLU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |