C17H23N3O4 — CID 97445979
(2S)-2-(2-hydroxyethyl)-N-[2-(2-methylprop-2-enoxy)phenyl]-3-oxopiperazine-1-carboxamide (PubChem CID 97445979) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2S)-2-(2-hydroxyethyl)-N-[2-(2-methylprop-2-enoxy)phenyl]-3-oxopiperazine-1-carboxamide.
| Compound Name | (2S)-2-(2-hydroxyethyl)-N-[2-(2-methylprop-2-enoxy)phenyl]-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 97445979 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2S)-2-(2-hydroxyethyl)-N-[2-(2-methylprop-2-enoxy)phenyl]-3-oxopiperazine-1-carboxamide |
| SMILES | C=C(C)COc1ccccc1NC(=O)N1CCNC(=O)[C@@H]1CCO |
| InChI | InChI=1S/C17H23N3O4/c1-12(2)11-24-15-6-4-3-5-13(15)19-17(23)20-9-8-18-16(22)14(20)7-10-21/h3-6,14,21H,1,7-11H2,2H3,(H,18,22)(H,19,23)/t14-/m0/s1 |
| InChIKey | ZEBFKFLJZSWTDY-AWEZNQCLSA-N |
| XLogP | 1.36 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|