C18H21N3O5 — CID 97453372
(2S)-N-[4-(furan-2-ylmethoxy)phenyl]-2-(2-hydroxyethyl)-3-oxopiperazine-1-carboxamide (PubChem CID 97453372) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2S)-N-[4-(furan-2-ylmethoxy)phenyl]-2-(2-hydroxyethyl)-3-oxopiperazine-1-carboxamide.
| Compound Name | (2S)-N-[4-(furan-2-ylmethoxy)phenyl]-2-(2-hydroxyethyl)-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 97453372 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2S)-N-[4-(furan-2-ylmethoxy)phenyl]-2-(2-hydroxyethyl)-3-oxopiperazine-1-carboxamide |
| SMILES | O=C1NCCN(C(=O)Nc2ccc(OCc3ccco3)cc2)[C@H]1CCO |
| InChI | InChI=1S/C18H21N3O5/c22-10-7-16-17(23)19-8-9-21(16)18(24)20-13-3-5-14(6-4-13)26-12-15-2-1-11-25-15/h1-6,11,16,22H,7-10,12H2,(H,19,23)(H,20,24)/t16-/m0/s1 |
| InChIKey | ZEYOLNZWZDTSHO-INIZCTEOSA-N |
| XLogP | 1.57 |
| TPSA | 104.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |