C21H26N6O — CID 97453689
(2R)-N-(2H-benzotriazol-4-yl)-2-[4-[(dimethylamino)methyl]phenyl]piperidine-1-carboxamide (PubChem CID 97453689) has the molecular formula C21H26N6O and a molecular weight of 378.48 g/mol. Its IUPAC name is (2R)-N-(2H-benzotriazol-4-yl)-2-[4-[(dimethylamino)methyl]phenyl]piperidine-1-carboxamide.
| Compound Name | (2R)-N-(2H-benzotriazol-4-yl)-2-[4-[(dimethylamino)methyl]phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97453689 |
| Molecular Formula | C21H26N6O |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2R)-N-(2H-benzotriazol-4-yl)-2-[4-[(dimethylamino)methyl]phenyl]piperidine-1-carboxamide |
| SMILES | CN(C)Cc1ccc([C@H]2CCCCN2C(=O)Nc2cccc3n[nH]nc23)cc1 |
| InChI | InChI=1S/C21H26N6O/c1-26(2)14-15-9-11-16(12-10-15)19-8-3-4-13-27(19)21(28)22-17-6-5-7-18-20(17)24-25-23-18/h5-7,9-12,19H,3-4,8,13-14H2,1-2H3,(H,22,28)(H,23,24,25)/t19-/m1/s1 |
| InChIKey | NJONCMVYOYAWSV-LJQANCHMSA-N |
| XLogP | 3.78 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |