C13H14F2N2O4 — CID 97453837
1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 97453837) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 97453837 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-(2,2-difluoro-1,3-benzodioxol-4-yl)-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCO1)Nc1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C13H14F2N2O4/c14-13(15)20-10-5-1-4-9(11(10)21-13)17-12(18)16-7-8-3-2-6-19-8/h1,4-5,8H,2-3,6-7H2,(H2,16,17,18)/t8-/m0/s1 |
| InChIKey | LQLNQYWYBVJYNQ-QMMMGPOBSA-N |
| XLogP | 2.31 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |