C23H26N4O2 — CID 97457137
(2S,3R)-N-[3-(benzimidazol-1-yl)propyl]-1-methyl-2-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 97457137) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is (2S,3R)-N-[3-(benzimidazol-1-yl)propyl]-1-methyl-2-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (2S,3R)-N-[3-(benzimidazol-1-yl)propyl]-1-methyl-2-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97457137 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (2S,3R)-N-[3-(benzimidazol-1-yl)propyl]-1-methyl-2-(4-methylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | Cc1ccc([C@@H]2[C@H](C(=O)NCCCn3cnc4ccccc43)CC(=O)N2C)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-16-8-10-17(11-9-16)22-18(14-21(28)26(22)2)23(29)24-12-5-13-27-15-25-19-6-3-4-7-20(19)27/h3-4,6-11,15,18,22H,5,12-14H2,1-2H3,(H,24,29)/t18-,22-/m1/s1 |
| InChIKey | AQKGXSORJLGTIX-XMSQKQJNSA-N |
| XLogP | 3.07 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|