C13H15F3N4O — CID 97457965
1-[(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 97457965) has the molecular formula C13H15F3N4O and a molecular weight of 300.28 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 97457965 |
| Molecular Formula | C13H15F3N4O |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[(3aR,6aS)-2-pyrimidin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1C[C@@H]2CN(c3ncccn3)C[C@@H]2C1 |
| InChI | InChI=1S/C13H15F3N4O/c14-13(15,16)4-11(21)19-5-9-7-20(8-10(9)6-19)12-17-2-1-3-18-12/h1-3,9-10H,4-8H2/t9-,10+ |
| InChIKey | PBTLORBAPWLEKJ-AOOOYVTPSA-N |
| XLogP | 1.32 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |