C18H20FN3OS — CID 97458763
(3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 97458763) has the molecular formula C18H20FN3OS and a molecular weight of 345.44 g/mol. Its IUPAC name is (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 97458763 |
| Molecular Formula | C18H20FN3OS |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (3aR,6aS)-1-[(3-fluorophenyl)methyl]-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | Cc1nc(CN2C(=O)C[C@H]3[C@H]2CCN3Cc2cccc(F)c2)cs1 |
| InChI | InChI=1S/C18H20FN3OS/c1-12-20-15(11-24-12)10-22-16-5-6-21(17(16)8-18(22)23)9-13-3-2-4-14(19)7-13/h2-4,7,11,16-17H,5-6,8-10H2,1H3/t16-,17+/m1/s1 |
| InChIKey | ILRMXVRWKKRPMX-SJORKVTESA-N |
| XLogP | 2.97 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |