C12H17N3OS — CID 98778785
(3aS,6aR)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one (PubChem CID 98778785) has the molecular formula C12H17N3OS and a molecular weight of 251.35 g/mol. Its IUPAC name is (3aS,6aR)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | (3aS,6aR)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 98778785 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | (3aS,6aR)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-3,3a,6,6a-tetrahydro-2H-pyrrolo[3,2-b]pyrrol-5-one |
| SMILES | Cc1nc(CN2CC[C@H]3[C@H]2CC(=O)N3C)cs1 |
| InChI | InChI=1S/C12H17N3OS/c1-8-13-9(7-17-8)6-15-4-3-10-11(15)5-12(16)14(10)2/h7,10-11H,3-6H2,1-2H3/t10-,11+/m0/s1 |
| InChIKey | MVFCLHUYVCCOFD-WDEREUQCSA-N |
| XLogP | 1.26 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |