C18H26N2O3 — CID 97459020
[(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 97459020) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is [(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 97459020 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(3aR,6aS)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2CC[C@H]3[C@H]2CCN3CC2CCOCC2)o1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-2-3-17(23-13)18(21)20-9-5-15-16(20)4-8-19(15)12-14-6-10-22-11-7-14/h2-3,14-16H,4-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | JIZKPCHELZUOGG-JKSUJKDBSA-N |
| XLogP | 2.30 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |