C16H22N2O4 — CID 124799216
(3aR,7aS)-4-(2-methoxyethyl)-1-(5-methylfuran-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 124799216) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3aR,7aS)-4-(2-methoxyethyl)-1-(5-methylfuran-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aR,7aS)-4-(2-methoxyethyl)-1-(5-methylfuran-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 124799216 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (3aR,7aS)-4-(2-methoxyethyl)-1-(5-methylfuran-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | COCCN1C(=O)CC[C@H]2[C@H]1CCN2C(=O)c1ccc(C)o1 |
| InChI | InChI=1S/C16H22N2O4/c1-11-3-5-14(22-11)16(20)18-8-7-13-12(18)4-6-15(19)17(13)9-10-21-2/h3,5,12-13H,4,6-10H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | NZZTXRXHIQDGTL-QWHCGFSZSA-N |
| XLogP | 1.44 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |