C13H16N2O3 — CID 124798570
(3aS,7aR)-1-(5-methylfuran-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one (PubChem CID 124798570) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is (3aS,7aR)-1-(5-methylfuran-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aR)-1-(5-methylfuran-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 124798570 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (3aS,7aR)-1-(5-methylfuran-2-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
| SMILES | Cc1ccc(C(=O)N2CC[C@@H]3NC(=O)CC[C@H]32)o1 |
| InChI | InChI=1S/C13H16N2O3/c1-8-2-4-11(18-8)13(17)15-7-6-9-10(15)3-5-12(16)14-9/h2,4,9-10H,3,5-7H2,1H3,(H,14,16)/t9-,10+/m0/s1 |
| InChIKey | LYRGGDNBBCZUCU-VHSXEESVSA-N |
| XLogP | 1.08 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |