C12H19N3O2 — CID 125252027
(3aS,7aR)-1-(pyrrolidine-1-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one (PubChem CID 125252027) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is (3aS,7aR)-1-(pyrrolidine-1-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | (3aS,7aR)-1-(pyrrolidine-1-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 125252027 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (3aS,7aR)-1-(pyrrolidine-1-carbonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC[C@@H]2[C@H](CCN2C(=O)N2CCCC2)N1 |
| InChI | InChI=1S/C12H19N3O2/c16-11-4-3-10-9(13-11)5-8-15(10)12(17)14-6-1-2-7-14/h9-10H,1-8H2,(H,13,16)/t9-,10+/m0/s1 |
| InChIKey | RQLLLQDEBPDBLB-VHSXEESVSA-N |
| XLogP | 0.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |