C14H15N5OS — CID 97459136
[(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 97459136) has the molecular formula C14H15N5OS and a molecular weight of 301.38 g/mol. Its IUPAC name is [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 97459136 |
| Molecular Formula | C14H15N5OS |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [(3aR,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1CC[C@H]2[C@H]1CCN2c1ncccn1 |
| InChI | InChI=1S/C14H15N5OS/c20-13(10-8-21-9-17-10)18-6-2-12-11(18)3-7-19(12)14-15-4-1-5-16-14/h1,4-5,8-9,11-12H,2-3,6-7H2/t11-,12+/m1/s1 |
| InChIKey | OWKWYCLUYXHHHK-NEPJUHHUSA-N |
| XLogP | 1.43 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |