C13H19FN4O — CID 97460269
(3R,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine (PubChem CID 97460269) has the molecular formula C13H19FN4O and a molecular weight of 266.32 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine.
| Compound Name | (3R,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97460269 |
| Molecular Formula | C13H19FN4O |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (3R,3aS,7aR)-1-(5-fluoropyrimidin-2-yl)-N,N-dimethyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
| SMILES | CN(C)[C@@H]1CN(c2ncc(F)cn2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C13H19FN4O/c1-17(2)11-8-18(10-4-3-5-19-12(10)11)13-15-6-9(14)7-16-13/h6-7,10-12H,3-5,8H2,1-2H3/t10-,11-,12+/m1/s1 |
| InChIKey | IILVSQCFYVHRCA-UTUOFQBUSA-N |
| XLogP | 0.91 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |