C19H25N3OS — CID 97460501
(3R,3aS,7aR)-N-methyl-N-(pyridin-3-ylmethyl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine (PubChem CID 97460501) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is (3R,3aS,7aR)-N-methyl-N-(pyridin-3-ylmethyl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine.
| Compound Name | (3R,3aS,7aR)-N-methyl-N-(pyridin-3-ylmethyl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97460501 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (3R,3aS,7aR)-N-methyl-N-(pyridin-3-ylmethyl)-1-(thiophen-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
| SMILES | CN(Cc1cccnc1)[C@@H]1CN(Cc2cccs2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C19H25N3OS/c1-21(12-15-5-2-8-20-11-15)18-14-22(13-16-6-4-10-24-16)17-7-3-9-23-19(17)18/h2,4-6,8,10-11,17-19H,3,7,9,12-14H2,1H3/t17-,18-,19+/m1/s1 |
| InChIKey | NPTOZEKDICTOTD-QRVBRYPASA-N |
| XLogP | 3.01 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |