C17H23N3O2 — CID 97460952
(3aS,7aS)-5-oxo-4-phenyl-N-propan-2-yl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carboxamide (PubChem CID 97460952) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3aS,7aS)-5-oxo-4-phenyl-N-propan-2-yl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carboxamide.
| Compound Name | (3aS,7aS)-5-oxo-4-phenyl-N-propan-2-yl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carboxamide |
|---|---|
| PubChem CID | 97460952 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3aS,7aS)-5-oxo-4-phenyl-N-propan-2-yl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carboxamide |
| SMILES | CC(C)NC(=O)N1CC[C@H]2[C@@H]1CCC(=O)N2c1ccccc1 |
| InChI | InChI=1S/C17H23N3O2/c1-12(2)18-17(22)19-11-10-15-14(19)8-9-16(21)20(15)13-6-4-3-5-7-13/h3-7,12,14-15H,8-11H2,1-2H3,(H,18,22)/t14-,15-/m0/s1 |
| InChIKey | BRDJUBLFFIJZGQ-GJZGRUSLSA-N |
| XLogP | 2.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |