C21H19N3O2 — CID 124784609
3-[(3aR,7aR)-5-oxo-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carbonyl]benzonitrile (PubChem CID 124784609) has the molecular formula C21H19N3O2 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[(3aR,7aR)-5-oxo-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carbonyl]benzonitrile.
| Compound Name | 3-[(3aR,7aR)-5-oxo-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 124784609 |
| Molecular Formula | C21H19N3O2 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 3-[(3aR,7aR)-5-oxo-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridine-1-carbonyl]benzonitrile |
| SMILES | N#Cc1cccc(C(=O)N2CC[C@@H]3[C@H]2CCC(=O)N3c2ccccc2)c1 |
| InChI | InChI=1S/C21H19N3O2/c22-14-15-5-4-6-16(13-15)21(26)23-12-11-19-18(23)9-10-20(25)24(19)17-7-2-1-3-8-17/h1-8,13,18-19H,9-12H2/t18-,19-/m1/s1 |
| InChIKey | QQNFMMIIWGKPRB-RTBURBONSA-N |
| XLogP | 2.97 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |