C16H24N4O — CID 97466923
N,N-dimethyl-1-[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine (PubChem CID 97466923) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is N,N-dimethyl-1-[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine |
|---|---|
| PubChem CID | 97466923 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | N,N-dimethyl-1-[7-[(5-methylfuran-2-yl)methyl]-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepin-3-yl]methanamine |
| SMILES | Cc1ccc(CN2CCc3ncc(CN(C)C)n3CC2)o1 |
| InChI | InChI=1S/C16H24N4O/c1-13-4-5-15(21-13)12-19-7-6-16-17-10-14(11-18(2)3)20(16)9-8-19/h4-5,10H,6-9,11-12H2,1-3H3 |
| InChIKey | UVIZLBSHVLAPGK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |