C15H17N5O4 — CID 97467794
2-[(furan-2-carbonylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide (PubChem CID 97467794) has the molecular formula C15H17N5O4 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-[(furan-2-carbonylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide.
| Compound Name | 2-[(furan-2-carbonylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 97467794 |
| Molecular Formula | C15H17N5O4 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 2-[(furan-2-carbonylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide |
| SMILES | NC(=O)N1CCCn2c(nc(CNC(=O)c3ccco3)cc2=O)C1 |
| InChI | InChI=1S/C15H17N5O4/c16-15(23)19-4-2-5-20-12(9-19)18-10(7-13(20)21)8-17-14(22)11-3-1-6-24-11/h1,3,6-7H,2,4-5,8-9H2,(H2,16,23)(H,17,22) |
| InChIKey | WZRXWHZVUZQXKS-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |