C18H18N4O4 — CID 97474042
6-[[(3aR,6aR)-5-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]pyridine-3-carbonitrile (PubChem CID 97474042) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 6-[[(3aR,6aR)-5-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]pyridine-3-carbonitrile.
| Compound Name | 6-[[(3aR,6aR)-5-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97474042 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 6-[[(3aR,6aR)-5-(4-methyl-1,3-oxazole-5-carbonyl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrol-3a-yl]methoxy]pyridine-3-carbonitrile |
| SMILES | Cc1ncoc1C(=O)N1C[C@@H]2COC[C@]2(COc2ccc(C#N)cn2)C1 |
| InChI | InChI=1S/C18H18N4O4/c1-12-16(26-11-21-12)17(23)22-6-14-7-24-9-18(14,8-22)10-25-15-3-2-13(4-19)5-20-15/h2-3,5,11,14H,6-10H2,1H3/t14-,18+/m1/s1 |
| InChIKey | APBKXDKAOSUDRW-KDOFPFPSSA-N |
| XLogP | 1.42 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |