C17H27N3O3 — CID 97474457
[(5S)-5-(ethoxymethyl)-3-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 97474457) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is [(5S)-5-(ethoxymethyl)-3-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [(5S)-5-(ethoxymethyl)-3-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97474457 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | [(5S)-5-(ethoxymethyl)-3-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | CCOC[C@H]1COCCC12CCN(C(=O)c1ccn(C)n1)CC2 |
| InChI | InChI=1S/C17H27N3O3/c1-3-22-12-14-13-23-11-7-17(14)5-9-20(10-6-17)16(21)15-4-8-19(2)18-15/h4,8,14H,3,5-7,9-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | NEVQGKVPPWKUPY-AWEZNQCLSA-N |
| XLogP | 1.72 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |