C16H26N4O2 — CID 131648665
[4-(dimethylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 131648665) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is [4-(dimethylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [4-(dimethylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 131648665 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [4-(dimethylamino)-1-oxa-9-azaspiro[5.5]undecan-9-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | CN(C)C1CCOC2(CCN(C(=O)c3ccn(C)n3)CC2)C1 |
| InChI | InChI=1S/C16H26N4O2/c1-18(2)13-5-11-22-16(12-13)6-9-20(10-7-16)15(21)14-4-8-19(3)17-14/h4,8,13H,5-7,9-12H2,1-3H3 |
| InChIKey | QWVBANIEJQFAPO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |