C20H25FN4O — CID 97476325
N-[2-[(3aS,7aR)-5-[(4-fluorophenyl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine (PubChem CID 97476325) has the molecular formula C20H25FN4O and a molecular weight of 356.44 g/mol. Its IUPAC name is N-[2-[(3aS,7aR)-5-[(4-fluorophenyl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine.
| Compound Name | N-[2-[(3aS,7aR)-5-[(4-fluorophenyl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 97476325 |
| Molecular Formula | C20H25FN4O |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-[2-[(3aS,7aR)-5-[(4-fluorophenyl)methyl]-2,3,4,6,7,7a-hexahydrofuro[3,2-c]pyridin-3a-yl]ethyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(CN2CC[C@H]3OCC[C@@]3(CCNc3ncccn3)C2)cc1 |
| InChI | InChI=1S/C20H25FN4O/c21-17-4-2-16(3-5-17)14-25-12-6-18-20(15-25,8-13-26-18)7-11-24-19-22-9-1-10-23-19/h1-5,9-10,18H,6-8,11-15H2,(H,22,23,24)/t18-,20+/m1/s1 |
| InChIKey | JLLBDMYTVRKFHG-QUCCMNQESA-N |
| XLogP | 3.10 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |