C17H28N4 — CID 97484598
2-(2-methylpropyl)-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecane (PubChem CID 97484598) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-(2-methylpropyl)-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecane.
| Compound Name | 2-(2-methylpropyl)-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97484598 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | 2-(2-methylpropyl)-9-pyrazin-2-yl-2,9-diazaspiro[5.5]undecane |
| SMILES | CC(C)CN1CCCC2(CCN(c3cnccn3)CC2)C1 |
| InChI | InChI=1S/C17H28N4/c1-15(2)13-20-9-3-4-17(14-20)5-10-21(11-6-17)16-12-18-7-8-19-16/h7-8,12,15H,3-6,9-11,13-14H2,1-2H3 |
| InChIKey | WHGRYVYJYWLWHI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |