C20H24N2O3 — CID 97484835
(3aS,7R,7aS)-4-[(3-methoxyphenyl)methyl]-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine (PubChem CID 97484835) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3aS,7R,7aS)-4-[(3-methoxyphenyl)methyl]-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine.
| Compound Name | (3aS,7R,7aS)-4-[(3-methoxyphenyl)methyl]-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 97484835 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (3aS,7R,7aS)-4-[(3-methoxyphenyl)methyl]-7-pyridin-2-yloxy-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
| SMILES | COc1cccc(CN2CC[C@@H](Oc3ccccn3)[C@H]3OCC[C@@H]32)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-23-16-6-4-5-15(13-16)14-22-11-8-18(20-17(22)9-12-24-20)25-19-7-2-3-10-21-19/h2-7,10,13,17-18,20H,8-9,11-12,14H2,1H3/t17-,18+,20-/m0/s1 |
| InChIKey | PVFACTBLBWVHRN-NSHGMRRFSA-N |
| XLogP | 2.90 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |