C17H26N4O2 — CID 97486462
N-cyclobutyl-2-[(3R)-4-(oxan-4-yl)morpholin-3-yl]pyrimidin-4-amine (PubChem CID 97486462) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-cyclobutyl-2-[(3R)-4-(oxan-4-yl)morpholin-3-yl]pyrimidin-4-amine.
| Compound Name | N-cyclobutyl-2-[(3R)-4-(oxan-4-yl)morpholin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 97486462 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-cyclobutyl-2-[(3R)-4-(oxan-4-yl)morpholin-3-yl]pyrimidin-4-amine |
| SMILES | c1cc(NC2CCC2)nc([C@@H]2COCCN2C2CCOCC2)n1 |
| InChI | InChI=1S/C17H26N4O2/c1-2-13(3-1)19-16-4-7-18-17(20-16)15-12-23-11-8-21(15)14-5-9-22-10-6-14/h4,7,13-15H,1-3,5-6,8-12H2,(H,18,19,20)/t15-/m0/s1 |
| InChIKey | JCKPVOVWGMJCKX-HNNXBMFYSA-N |
| XLogP | 1.99 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |