C15H19N5O3 — CID 97486583
[(2R,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrazol-3-yl)methanone (PubChem CID 97486583) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is [(2R,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrazol-3-yl)methanone.
| Compound Name | [(2R,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 97486583 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | [(2R,3aS,6aS)-2-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl]-(1-methylpyrazol-3-yl)methanone |
| SMILES | Cc1noc(C[C@H]2C[C@H]3CN(C(=O)c4ccn(C)n4)C[C@H]3O2)n1 |
| InChI | InChI=1S/C15H19N5O3/c1-9-16-14(23-18-9)6-11-5-10-7-20(8-13(10)22-11)15(21)12-3-4-19(2)17-12/h3-4,10-11,13H,5-8H2,1-2H3/t10-,11+,13+/m0/s1 |
| InChIKey | CFYNFDSDDZKJDI-DMDPSCGWSA-N |
| XLogP | 0.58 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |