C12H21NO2 — CID 97489671
(3R,5R)-3-(cyclopropylmethoxy)-1-oxa-9-azaspiro[4.5]decane (PubChem CID 97489671) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (3R,5R)-3-(cyclopropylmethoxy)-1-oxa-9-azaspiro[4.5]decane.
| Compound Name | (3R,5R)-3-(cyclopropylmethoxy)-1-oxa-9-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 97489671 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3R,5R)-3-(cyclopropylmethoxy)-1-oxa-9-azaspiro[4.5]decane |
| SMILES | C1CNC[C@@]2(C1)C[C@@H](OCC1CC1)CO2 |
| InChI | InChI=1S/C12H21NO2/c1-4-12(9-13-5-1)6-11(8-15-12)14-7-10-2-3-10/h10-11,13H,1-9H2/t11-,12-/m1/s1 |
| InChIKey | AQODFIDQIAZJLK-VXGBXAGGSA-N |
| XLogP | 1.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |