C20H19F3N2O4 — CID 97496755
(3S)-1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide (PubChem CID 97496755) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is (3S)-1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 97496755 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | (3S)-1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(3,4,5-trifluorophenyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1OCCN1C[C@@H](C(=O)Nc2cc(F)c(F)c(F)c2)CC1=O |
| InChI | InChI=1S/C20H19F3N2O4/c1-28-16-4-2-3-5-17(16)29-7-6-25-11-12(8-18(25)26)20(27)24-13-9-14(21)19(23)15(22)10-13/h2-5,9-10,12H,6-8,11H2,1H3,(H,24,27)/t12-/m0/s1 |
| InChIKey | BQAJMCKJNDXVAN-LBPRGKRZSA-N |
| XLogP | 2.98 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|