C20H23N3O4 — CID 75490757
1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 75490757) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 75490757 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[2-(2-methoxyphenoxy)ethyl]-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | COc1ccccc1OCCN1CC(C(=O)NCc2cccnc2)CC1=O |
| InChI | InChI=1S/C20H23N3O4/c1-26-17-6-2-3-7-18(17)27-10-9-23-14-16(11-19(23)24)20(25)22-13-15-5-4-8-21-12-15/h2-8,12,16H,9-11,13-14H2,1H3,(H,22,25) |
| InChIKey | KRKRFGJSVAREAO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |