About 2-Nonenoic acid
2-Nonenoic acid (PubChem CID 97730) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is non-2-enoic acid.
Molecular Properties
| Compound Name | 2-Nonenoic acid |
| PubChem CID | 97730 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | non-2-enoic acid |
| SMILES | CCCCCCC=CC(=O)O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11) |
| InChIKey | ADLXTJMPCFOTOO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | 128 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-Nonenoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Nonenoic acid?
The IUPAC name of 2-Nonenoic acid (CID 97730) is non-2-enoic acid.
What is the SMILES notation for 2-Nonenoic acid?
The canonical SMILES for 2-Nonenoic acid is CCCCCCC=CC(=O)O.
What is the InChIKey of 2-Nonenoic acid?
The InChIKey is ADLXTJMPCFOTOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11).
What are the key properties of 2-Nonenoic acid?
2-Nonenoic acid has a molecular weight of 156.22 g/mol, XLogP of 3.20, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Nonenoic acid is sourced from PubChem (CID 97730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).