C13H16O7 — CID 98007574
propyl (2R)-3-acetyl-4-hydroxy-5-oxo-2-(2-oxopropyl)furan-2-carboxylate (PubChem CID 98007574) has the molecular formula C13H16O7 and a molecular weight of 284.26 g/mol. Its IUPAC name is propyl (2R)-3-acetyl-4-hydroxy-5-oxo-2-(2-oxopropyl)furan-2-carboxylate.
| Compound Name | propyl (2R)-3-acetyl-4-hydroxy-5-oxo-2-(2-oxopropyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 98007574 |
| Molecular Formula | C13H16O7 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | propyl (2R)-3-acetyl-4-hydroxy-5-oxo-2-(2-oxopropyl)furan-2-carboxylate |
| SMILES | CCCOC(=O)[C@]1(CC(C)=O)OC(=O)C(O)=C1C(C)=O |
| InChI | InChI=1S/C13H16O7/c1-4-5-19-12(18)13(6-7(2)14)9(8(3)15)10(16)11(17)20-13/h16H,4-6H2,1-3H3/t13-/m1/s1 |
| InChIKey | SGDCBRHHICWCPX-CYBMUJFWSA-N |
| XLogP | 0.62 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |