C15H21NO — CID 98014651
5-(4-ethoxy-2,5-dimethylphenyl)pentanenitrile (PubChem CID 98014651) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-(4-ethoxy-2,5-dimethylphenyl)pentanenitrile.
| Compound Name | 5-(4-ethoxy-2,5-dimethylphenyl)pentanenitrile |
|---|---|
| PubChem CID | 98014651 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 5-(4-ethoxy-2,5-dimethylphenyl)pentanenitrile |
| SMILES | CCOc1cc(C)c(CCCCC#N)cc1C |
| InChI | InChI=1S/C15H21NO/c1-4-17-15-11-12(2)14(10-13(15)3)8-6-5-7-9-16/h10-11H,4-8H2,1-3H3 |
| InChIKey | UDBNJSAVRXGRJL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|