C15H22O — CID 83940881
1-ethoxy-2,5-dimethyl-4-[(Z)-pent-3-enyl]benzene (PubChem CID 83940881) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-ethoxy-2,5-dimethyl-4-[(Z)-pent-3-enyl]benzene.
| Compound Name | 1-ethoxy-2,5-dimethyl-4-[(Z)-pent-3-enyl]benzene |
|---|---|
| PubChem CID | 83940881 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-ethoxy-2,5-dimethyl-4-[(Z)-pent-3-enyl]benzene |
| SMILES | C/C=C\CCc1cc(C)c(OCC)cc1C |
| InChI | InChI=1S/C15H22O/c1-5-7-8-9-14-10-13(4)15(16-6-2)11-12(14)3/h5,7,10-11H,6,8-9H2,1-4H3/b7-5- |
| InChIKey | BWEVKJWUXZGCDR-ALCCZGGFSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|