C16H26O2 — CID 98016089
6-(4-methoxy-2,5-dimethylphenyl)-2-methylhexan-2-ol (PubChem CID 98016089) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 6-(4-methoxy-2,5-dimethylphenyl)-2-methylhexan-2-ol.
| Compound Name | 6-(4-methoxy-2,5-dimethylphenyl)-2-methylhexan-2-ol |
|---|---|
| PubChem CID | 98016089 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 6-(4-methoxy-2,5-dimethylphenyl)-2-methylhexan-2-ol |
| SMILES | COc1cc(C)c(CCCCC(C)(C)O)cc1C |
| InChI | InChI=1S/C16H26O2/c1-12-11-15(18-5)13(2)10-14(12)8-6-7-9-16(3,4)17/h10-11,17H,6-9H2,1-5H3 |
| InChIKey | HKOBJRWYAVKRKR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|