C10H14Cl2O2S — CID 98018182
2-chloro-5-(4-chloro-1,1-dimethoxybutyl)thiophene (PubChem CID 98018182) has the molecular formula C10H14Cl2O2S and a molecular weight of 269.19 g/mol. Its IUPAC name is 2-chloro-5-(4-chloro-1,1-dimethoxybutyl)thiophene.
| Compound Name | 2-chloro-5-(4-chloro-1,1-dimethoxybutyl)thiophene |
|---|---|
| PubChem CID | 98018182 |
| Molecular Formula | C10H14Cl2O2S |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-chloro-5-(4-chloro-1,1-dimethoxybutyl)thiophene |
| SMILES | COC(CCCCl)(OC)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H14Cl2O2S/c1-13-10(14-2,6-3-7-11)8-4-5-9(12)15-8/h4-5H,3,6-7H2,1-2H3 |
| InChIKey | VZILYPGWCFWRGJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|