C22H18N2O4 — CID 980254
[2,8-dimethyl-4-oxo-3-(1-phenylpyrazol-4-yl)chromen-7-yl] acetate (PubChem CID 980254) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is [2,8-dimethyl-4-oxo-3-(1-phenylpyrazol-4-yl)chromen-7-yl] acetate.
| Compound Name | [2,8-dimethyl-4-oxo-3-(1-phenylpyrazol-4-yl)chromen-7-yl] acetate |
|---|---|
| PubChem CID | 980254 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [2,8-dimethyl-4-oxo-3-(1-phenylpyrazol-4-yl)chromen-7-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(=O)c(-c3cnn(-c4ccccc4)c3)c(C)oc2c1C |
| InChI | InChI=1S/C22H18N2O4/c1-13-19(28-15(3)25)10-9-18-21(26)20(14(2)27-22(13)18)16-11-23-24(12-16)17-7-5-4-6-8-17/h4-12H,1-3H3 |
| InChIKey | OYUSSVOARKWFPL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|