C16H22N2O — CID 98032946
N-[3-(7-methoxy-1-methylindol-3-yl)propyl]cyclopropanamine (PubChem CID 98032946) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is N-[3-(7-methoxy-1-methylindol-3-yl)propyl]cyclopropanamine.
| Compound Name | N-[3-(7-methoxy-1-methylindol-3-yl)propyl]cyclopropanamine |
|---|---|
| PubChem CID | 98032946 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[3-(7-methoxy-1-methylindol-3-yl)propyl]cyclopropanamine |
| SMILES | COc1cccc2c(CCCNC3CC3)cn(C)c12 |
| InChI | InChI=1S/C16H22N2O/c1-18-11-12(5-4-10-17-13-8-9-13)14-6-3-7-15(19-2)16(14)18/h3,6-7,11,13,17H,4-5,8-10H2,1-2H3 |
| InChIKey | HNWVACUOKHBIPD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|