C18H17NO2 — CID 98035044
3-(2-methyl-5-phenyl-1H-indol-3-yl)propanoic acid (PubChem CID 98035044) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(2-methyl-5-phenyl-1H-indol-3-yl)propanoic acid.
| Compound Name | 3-(2-methyl-5-phenyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 98035044 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-(2-methyl-5-phenyl-1H-indol-3-yl)propanoic acid |
| SMILES | Cc1[nH]c2ccc(-c3ccccc3)cc2c1CCC(=O)O |
| InChI | InChI=1S/C18H17NO2/c1-12-15(8-10-18(20)21)16-11-14(7-9-17(16)19-12)13-5-3-2-4-6-13/h2-7,9,11,19H,8,10H2,1H3,(H,20,21) |
| InChIKey | VMNIXSXOZLLBJL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|