C8H13N5O — CID 98042456
1-[[(2R)-pyrrolidin-2-yl]methyl]triazole-4-carboxamide (PubChem CID 98042456) has the molecular formula C8H13N5O and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-[[(2R)-pyrrolidin-2-yl]methyl]triazole-4-carboxamide.
| Compound Name | 1-[[(2R)-pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 98042456 |
| Molecular Formula | C8H13N5O |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-[[(2R)-pyrrolidin-2-yl]methyl]triazole-4-carboxamide |
| SMILES | NC(=O)c1cn(C[C@H]2CCCN2)nn1 |
| InChI | InChI=1S/C8H13N5O/c9-8(14)7-5-13(12-11-7)4-6-2-1-3-10-6/h5-6,10H,1-4H2,(H2,9,14)/t6-/m1/s1 |
| InChIKey | NZOQNECJJBLKEO-ZCFIWIBFSA-N |
| XLogP | -0.87 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |