C15H29N6O+ — CID 134959534
3-acetamidopropyl-dimethyl-[[1-[[(2S)-pyrrolidin-2-yl]methyl]triazol-4-yl]methyl]azanium (PubChem CID 134959534) has the molecular formula C15H29N6O+ and a molecular weight of 309.44 g/mol. Its IUPAC name is 3-acetamidopropyl-dimethyl-[[1-[[(2S)-pyrrolidin-2-yl]methyl]triazol-4-yl]methyl]azanium.
| Compound Name | 3-acetamidopropyl-dimethyl-[[1-[[(2S)-pyrrolidin-2-yl]methyl]triazol-4-yl]methyl]azanium |
|---|---|
| PubChem CID | 134959534 |
| Molecular Formula | C15H29N6O+ |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 3-acetamidopropyl-dimethyl-[[1-[[(2S)-pyrrolidin-2-yl]methyl]triazol-4-yl]methyl]azanium |
| SMILES | CC(=O)NCCC[N+](C)(C)Cc1cn(C[C@@H]2CCCN2)nn1 |
| InChI | InChI=1S/C15H28N6O/c1-13(22)16-8-5-9-21(2,3)12-15-11-20(19-18-15)10-14-6-4-7-17-14/h11,14,17H,4-10,12H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | KELTYZALPWQKGU-AWEZNQCLSA-O |
| XLogP | 0.13 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|