C28H29N3O4 — CID 98046043
(1R,9S,13S)-10-benzyl-N-(2,4-dimethylphenyl)-6-methoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 98046043) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is (1R,9S,13S)-10-benzyl-N-(2,4-dimethylphenyl)-6-methoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-10-benzyl-N-(2,4-dimethylphenyl)-6-methoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 98046043 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (1R,9S,13S)-10-benzyl-N-(2,4-dimethylphenyl)-6-methoxy-9-methyl-11-oxo-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1cccc2c1O[C@@]1(C)[C@@H](C(=O)Nc3ccc(C)cc3C)[C@H]2NC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H29N3O4/c1-17-13-14-21(18(2)15-17)29-26(32)23-24-20-11-8-12-22(34-4)25(20)35-28(23,3)31(27(33)30-24)16-19-9-6-5-7-10-19/h5-15,23-24H,16H2,1-4H3,(H,29,32)(H,30,33)/t23-,24+,28+/m1/s1 |
| InChIKey | WIWJMLULNHEXMN-NYULUDCUSA-N |
| XLogP | 4.94 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |