C30H31N3O5S — CID 4075660
10-(1,3-benzodioxol-5-ylmethyl)-N-(2,4-dimethylphenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 4075660) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-ylmethyl)-N-(2,4-dimethylphenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 10-(1,3-benzodioxol-5-ylmethyl)-N-(2,4-dimethylphenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 4075660 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | 10-(1,3-benzodioxol-5-ylmethyl)-N-(2,4-dimethylphenyl)-6-ethoxy-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | CCOc1cccc2c1OC1(C)C(C(=O)Nc3ccc(C)cc3C)C2NC(=S)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H31N3O5S/c1-5-35-23-8-6-7-20-26-25(28(34)31-21-11-9-17(2)13-18(21)3)30(4,38-27(20)23)33(29(39)32-26)15-19-10-12-22-24(14-19)37-16-36-22/h6-14,25-26H,5,15-16H2,1-4H3,(H,31,34)(H,32,39) |
| InChIKey | PTQUFAUGFODENX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|