C28H26BrN3O4S — CID 98045824
(1R,9S,13R)-10-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 98045824) has the molecular formula C28H26BrN3O4S and a molecular weight of 580.50 g/mol. Its IUPAC name is (1R,9S,13R)-10-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13R)-10-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 98045824 |
| Molecular Formula | C28H26BrN3O4S |
| Molecular Weight | 580.50 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | (1R,9S,13R)-10-(1,3-benzodioxol-5-ylmethyl)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2[C@H]3NC(=S)N(Cc4ccc5c(c4)OCO5)[C@@]2(C)Oc2ccc(Br)cc23)c(C)c1 |
| InChI | InChI=1S/C28H26BrN3O4S/c1-15-4-7-20(16(2)10-15)30-26(33)24-25-19-12-18(29)6-9-21(19)36-28(24,3)32(27(37)31-25)13-17-5-8-22-23(11-17)35-14-34-22/h4-12,24-25H,13-14H2,1-3H3,(H,30,33)(H,31,37)/t24-,25-,28-/m0/s1 |
| InChIKey | DNSBVBWTTQDCPG-VBOOUTDYSA-N |
| XLogP | 5.59 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|