C24H27NO9 — CID 98051875
[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methyl 2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetate (PubChem CID 98051875) has the molecular formula C24H27NO9 and a molecular weight of 473.48 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methyl 2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methyl 2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetate |
|---|---|
| PubChem CID | 98051875 |
| Molecular Formula | C24H27NO9 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[2-(4-hydroxyphenyl)ethoxy]oxan-2-yl]methyl 2-[(3R)-2-oxo-1,3-dihydroindol-3-yl]acetate |
| SMILES | O=C(C[C@H]1C(=O)Nc2ccccc21)OC[C@H]1O[C@@H](OCCc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H27NO9/c26-14-7-5-13(6-8-14)9-10-32-24-22(30)21(29)20(28)18(34-24)12-33-19(27)11-16-15-3-1-2-4-17(15)25-23(16)31/h1-8,16,18,20-22,24,26,28-30H,9-12H2,(H,25,31)/t16-,18-,20-,21+,22-,24-/m1/s1 |
| InChIKey | YOTVUKXKJYRTAR-XCTMEYGKSA-N |
| XLogP | 0.43 |
| TPSA | 154.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |