C32H34N2O4S — CID 98054298
(2S)-N-[4-(1-adamantyl)phenyl]-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 98054298) has the molecular formula C32H34N2O4S and a molecular weight of 542.70 g/mol. Its IUPAC name is (2S)-N-[4-(1-adamantyl)phenyl]-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-N-[4-(1-adamantyl)phenyl]-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 98054298 |
| Molecular Formula | C32H34N2O4S |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | (2S)-N-[4-(1-adamantyl)phenyl]-4-benzylsulfonyl-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1)[C@@H]1CN(S(=O)(=O)Cc2ccccc2)c2ccccc2O1 |
| InChI | InChI=1S/C32H34N2O4S/c35-31(33-27-12-10-26(11-13-27)32-17-23-14-24(18-32)16-25(15-23)19-32)30-20-34(28-8-4-5-9-29(28)38-30)39(36,37)21-22-6-2-1-3-7-22/h1-13,23-25,30H,14-21H2,(H,33,35)/t23?,24?,25?,30-,32?/m0/s1 |
| InChIKey | XCAOJQBHEIXGEP-KADOXKNZSA-N |
| XLogP | 5.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |